N-[(3-nitrophenyl)methyl]aniline structure
|
Common Name | N-[(3-nitrophenyl)methyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 3430-70-4 | Molecular Weight | 228.24700 | |
| Density | 1.258g/cm3 | Boiling Point | 398.4ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.7ºC | |
| Name | N-[(3-nitrophenyl)methyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 398.4ºC at 760 mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 194.7ºC |
| Exact Mass | 228.09000 |
| PSA | 57.85000 |
| LogP | 3.80310 |
| Index of Refraction | 1.658 |
| InChIKey | HLBXJHXQMHGOEL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(CNc2ccccc2)c1 |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-<3-Nitro-benzyl>-anilin |
| N-anilinomethyl-3-nitrobenzene |