Ornipressin structure
|
Common Name | Ornipressin | ||
|---|---|---|---|---|
| CAS Number | 3397-23-7 | Molecular Weight | 1042.192 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1616.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C45H63N13O12S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 931.3±34.3 °C | |
Use of OrnipressinOrnipressin is a potent vasoconstrictor, hemostatic and renal agent. Sequence: Cys-Tyr-Phe-Gln-Asn-Cys-Pro-{Orn}-Gly-NH2 (Disulfide bridge: Cys1-Cys6). |
| Name | Ornipressin |
|---|---|
| Synonym | More Synonyms |
| Description | Ornipressin is a potent vasoconstrictor, hemostatic and renal agent. Sequence: Cys-Tyr-Phe-Gln-Asn-Cys-Pro-{Orn}-Gly-NH2 (Disulfide bridge: Cys1-Cys6). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1616.2±65.0 °C at 760 mmHg |
| Molecular Formula | C45H63N13O12S2 |
| Molecular Weight | 1042.192 |
| Flash Point | 931.3±34.3 °C |
| Exact Mass | 1041.416016 |
| PSA | 476.15000 |
| LogP | -5.66 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | MUNMIGOEDGHVLE-MTUUWTMYSA-N |
| SMILES | NCCCC(NC(=O)C1CCCN1C(=O)C1CSSCC(N)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(Cc2ccccc2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)N1)C(=O)NCC(N)=O |
| Storage condition | -20°C |
| Hazard Codes | F,Xi,N |
|---|---|
| Risk Phrases | R11:Highly Flammable. R36/37/38:Irritating to eyes, respiratory system and skin . R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment . R10:Flammable. |
| Safety Phrases | S16-S26-S60-S37/39 |
| RIDADR | UN 1126 3/PG 2 |
| WGK Germany | 2 |
| RTECS | EJ6225000 |
| Packaging Group | II |
| Hazard Class | 3 |
| HS Code | 29033036 |
| HS Code | 29033036 |
|---|
| Glycinamide, 1-[[(4R,7S,10S,13S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-16-[(4-hydroxyphenyl)methyl]-6,9,12,15,18-pentaoxo-13-(phenylmethyl)-1,2-dithia-5,8,11,14,17-pentaazacycloeicos-4-yl]carbonyl]-L-prolyl-L-ornithyl- |
| POR-8 |
| 8-Ornithinevasopressin |
| 8-L-Ornithinevasopressin |
| 8-L-Ornithine-vasopressin |
| EINECS 222-253-8 |
| 8-ornipressin vasopressin |
| Ornithine-vasopressin |
| vasopressin 8-ornithine |
| POR-8 Sandoz |
| Orn8-vasopressin |
| 1-{[(4R,7S,10S,13S,16S,19R)-19-Amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-16-(4-hydroxybenzyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-ornithylglycinamide |
| Ornipressin Acetate |