pht-gly-osu structure
|
Common Name | pht-gly-osu | ||
|---|---|---|---|---|
| CAS Number | 3397-29-3 | Molecular Weight | 302.23900 | |
| Density | 1.61g/cm3 | Boiling Point | 469.7ºC at 760 mmHg | |
| Molecular Formula | C14H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.9ºC | |
| Name | (2,5-dioxopyrrolidin-3-yl) 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 469.7ºC at 760 mmHg |
| Molecular Formula | C14H10N2O6 |
| Molecular Weight | 302.23900 |
| Flash Point | 237.9ºC |
| Exact Mass | 302.05400 |
| PSA | 101.06000 |
| Appearance of Characters | Solid |
| Index of Refraction | 1.666 |
| InChIKey | NQZZTHXHURDXOR-UHFFFAOYSA-N |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)ON1C(=O)CCC1=O |
| HS Code | 2925190090 |
|---|
|
~%
pht-gly-osu CAS#:3397-29-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 29, # 10 p. 1922 - 1929 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-Phthaloyl-glycin-N-hydroxy-succinimid-ester |
| QC-3161 |
| N-phthaloylglycine N-hydroxysuccinimide ester |