Z-Phe-OSu
Z-Phe-OSu structure
|
Common Name | Z-Phe-OSu | ||
|---|---|---|---|---|
| CAS Number | 3397-32-8 | Molecular Weight | 396.393 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.393 |
| Exact Mass | 396.132141 |
| PSA | 102.01000 |
| LogP | 2.12 |
| Appearance of Characters | Solid |
| Index of Refraction | 1.618 |
| InChIKey | MOJNKVWQJKPXCT-KRWDZBQOSA-N |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)ON1C(=O)CCC1=O)OCc1ccccc1 |
| Storage condition | -15°C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 7 | |
CAS#:6066-82-6
CAS#:1161-13-3
CAS#:107960-02-1
CAS#:63-91-2
CAS#:501-53-1
CAS#:57296-03-4
CAS#:74124-79-1
CAS#:6372-14-1
CAS#:59830-60-3
CAS#:13123-00-7
CAS#:35373-92-3
CAS#:1238-09-1
CAS#:7669-64-9
CAS#:54745-27-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,5-Dioxo-1-pyrrolidinyl N-[(benzyloxy)carbonyl]-L-phenylalaninate |
| Z-L-Phe-OH N-succinimidyl ester |
| Cbz-L-Phe-OSuc |
| 2,5-Dioxo-1-pyrrolidinyl N-[(benzyloxy)carbonyl]phenylalaninate |
| L-phenylalanine, N-[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| Z-L-Phe-OSu |
| 2,5-Dioxopyrrolidin-1-yl N-[(benzyloxy)carbonyl]-L-phenylalaninate |
| Cbz-L-Phe-OSu |
| Phenylalanine, N-[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| EINECS 222-254-3 |
| Z-Phe-ONSu |
| Benzyl (S)-(2-((2,5-dioxo-1-pyrrolidinyl)oxy)-2-oxo-1-(phenylmethyl)ethyl)-carbamate |
| Z-Phe-Osu |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: Related downstream products(CAS) of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate: 6372-14-1;59830-60-3;13123-00-7;35373-92-3;1238-09-1;7669-64-9;54745-27-6. |
| Q: What is the polar surface area (PSA) of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: Polar surface area (PSA) of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate is 102.01000. |
| Q: What is the molecular weight of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: Molecular weight of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate is 396.393. |
| Q: What is the CAS number of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: CAS number of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate is 3397-32-8. |
| Q: What are the storage conditions for (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: Storage conditions for (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate: -15°C. |
| Q: What is the physical appearance of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate appears as Solid. |
| Q: What is the SMILES notation of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: SMILES notation of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate is O=C(NC(Cc1ccccc1)C(=O)ON1C(=O)CCC1=O)OCc1ccccc1. |
| Q: What are the upstream materials of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: Related upstream materials(CAS) of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate: 6066-82-6;1161-13-3;107960-02-1;63-91-2;501-53-1;57296-03-4;74124-79-1. |
| Q: What is the LogP of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: LogP of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate is 2.12. |
| Q: What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate? |
| A: InChIKey of (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate is MOJNKVWQJKPXCT-KRWDZBQOSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |