Tebuthiuron structure
|
Common Name | Tebuthiuron | ||
|---|---|---|---|---|
| CAS Number | 34014-18-1 | Molecular Weight | 228.314 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H16N4OS | Melting Point | 161-164°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | tebuthiuron |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Melting Point | 161-164°C |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.314 |
| Exact Mass | 228.104477 |
| PSA | 86.36000 |
| LogP | 1.79 |
| Index of Refraction | 1.555 |
| InChIKey | HBPDKDSFLXWOAE-UHFFFAOYSA-N |
| SMILES | CNC(=O)N(C)c1nnc(C(C)(C)C)s1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H410 |
| Precautionary Statements | P301 + P312 + P330 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
| Risk Phrases | R22;R50/53 |
| Safety Phrases | S37-S60-S61 |
| RIDADR | UN 3077 |
| RTECS | YS4250000 |
| HS Code | 2934999090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Heterogeneous photocatalysed reaction of three selected pesticide derivatives, propham, propachlor and tebuthiuron in aqueous suspensions of titanium dioxide.
Chemosphere 61(4) , 457-68, (2005) Heterogeneous photocatalysed reaction of three selected pesticide derivatives such as propham (1), propachlor (2) and tebuthiuron (3) has been investigated in aqueous suspensions of titanium dioxide b... |
|
|
A comparative study of the electrochemical oxidation of the herbicide tebuthiuron using boron-doped diamond electrodes.
Chemosphere 88(2) , 155-60, (2012) The thiadiazolylurea derivative tebuthiuron (TBH) is commonly used as an herbicide even though it is highly toxic to humans. While various processes have been proposed for the removal of organic conta... |
|
|
Multivariate analysis of photo-Fenton degradation of the herbicides tebuthiuron, diuron and 2,4-D.
Chemosphere 58(8) , 1107-16, (2005) The degradation of herbicides in aqueous solution by photo-Fenton process using ferrioxalate complex (FeOx) as source of Fe2+ was evaluated under blacklight irradiation. The commercial products of the... |
| 1,3-Dimethyl-1-[5-(2-methyl-2-propanyl)-1,3,4-thiadiazol-2-yl]urea |
| N-[5-(1,1-Dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N'-dimethylurea |
| Tebuthiuron |
| 1-(5-(tert-Butyl)-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea |
| Brulan |
| Preflan |
| EL-103 |
| E-103 |
| TEBUSAN |
| N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-N,N'-dimethylurea |
| SPIKE |
| Perflan |
| EI-103 |
| Graslan |
| MFCD00078732 |
| N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-N,N’-dimethylurea |
| EINECS 251-793-7 |
| Urea, N-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N'-dimethyl- |
| N-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N’-dimethylurea |
| 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea |
| Perfmid |