(S)-2-Amino-3-(4-sulfophenyl)propanoic acid structure
|
Common Name | (S)-2-Amino-3-(4-sulfophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 34023-49-9 | Molecular Weight | 245.25200 | |
| Density | 1.53g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-sulfonic acid-l-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Molecular Formula | C9H11NO5S |
| Molecular Weight | 245.25200 |
| Exact Mass | 245.03600 |
| PSA | 126.07000 |
| LogP | 1.66880 |
| Index of Refraction | 1.619 |
| InChIKey | ALQIUGWFHKQQHV-QMMMGPOBSA-N |
| SMILES | NC(Cc1ccc(S(=O)(=O)O)cc1)C(=O)O |
| HS Code | 2922499990 |
|---|
|
~44%
(S)-2-Amino-3-(... CAS#:34023-49-9 |
| Literature: Escher; Bernier; Parent Helvetica Chimica Acta, 1983 , vol. 66, # 5 p. 1355 - 1365 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| L-p-Sulfonylphenylalanin |
| H-S-PHE(4-SO3H)-OH |
| (S)-PHENYLALANINE-4-SULFONIC ACID |
| L-4-sulfophenylalanine |
| 4-sulfo-L-phenylalanine |
| P-SULFONIC ACID-L-PHENYLALANINE |
| (S)-4-(SULFONIC ACID)-PHENYLALANINE |