1,3-dibromo-9H-fluoren-2-amine structure
|
Common Name | 1,3-dibromo-9H-fluoren-2-amine | ||
|---|---|---|---|---|
| CAS Number | 3405-09-2 | Molecular Weight | 339.02500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9Br2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dibromo-9H-fluoren-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9Br2N |
|---|---|
| Molecular Weight | 339.02500 |
| Exact Mass | 336.91000 |
| PSA | 26.02000 |
| LogP | 4.94620 |
| InChIKey | LHRWVIZWZMXYPI-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc2c(c1Br)Cc1ccccc1-2 |
| HS Code | 2921499090 |
|---|
|
~%
1,3-dibromo-9H-... CAS#:3405-09-2 |
| Literature: Fletcher,T.L.; Pan,H.-L. Journal of the Chemical Society, 1965 , p. 4588 - 4591 |
|
~%
1,3-dibromo-9H-... CAS#:3405-09-2 |
| Literature: Fletcher et al. Chemistry and Industry (London, United Kingdom), 1957 , p. 660 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,3-Dibrom-fluoren-2-ylamin |
| 9H-Fluoren-2-amine,1,3-dibromo |
| 2-Amino-1,3-dibromofluorene |
| 1,3-Dibrom-2-amino-fluoren |
| 1,3-dibromo-fluoren-2-ylamine |
| 1,3-Dibromo-9H-fluoren-2-ylamine |