8-phenyl-2,5,8-triazabicyclo[4.3.0]nona-1,3,5-triene-7,9-dione structure
|
Common Name | 8-phenyl-2,5,8-triazabicyclo[4.3.0]nona-1,3,5-triene-7,9-dione | ||
|---|---|---|---|---|
| CAS Number | 34067-85-1 | Molecular Weight | 225.20300 | |
| Density | 1.469g/cm3 | Boiling Point | 429.5ºC at 760 mmHg | |
| Molecular Formula | C12H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 6-phenylpyrrolo[3,4-b]pyrazine-5,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 429.5ºC at 760 mmHg |
| Molecular Formula | C12H7N3O2 |
| Molecular Weight | 225.20300 |
| Flash Point | 213.5ºC |
| Exact Mass | 225.05400 |
| PSA | 63.16000 |
| LogP | 1.34220 |
| Index of Refraction | 1.685 |
| InChIKey | NGURXCICVNLPDD-UHFFFAOYSA-N |
| SMILES | O=C1c2nccnc2C(=O)N1c1ccccc1 |
|
~89%
8-phenyl-2,5,8-... CAS#:34067-85-1 |
| Literature: Abdel-Aziz, Alaa A.-M. European Journal of Medicinal Chemistry, 2007 , vol. 42, # 5 p. 614 - 626 |
|
~85%
8-phenyl-2,5,8-... CAS#:34067-85-1 |
| Literature: Abdel-Aziz, Alaa A.-M. European Journal of Medicinal Chemistry, 2007 , vol. 42, # 5 p. 614 - 626 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS1548L10 |
| pyrazin-2,3-dicarbonsaeure-N-phenylimid |