2-(1,4-dioxonaphthalen-2-yl)naphthalene-1,4-dione structure
|
Common Name | 2-(1,4-dioxonaphthalen-2-yl)naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 3408-13-7 | Molecular Weight | 314.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,4-dioxonaphthalen-2-yl)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H10O4 |
|---|---|
| Molecular Weight | 314.29100 |
| Exact Mass | 314.05800 |
| PSA | 68.28000 |
| LogP | 2.99760 |
| InChIKey | QWYZAMKNTSAAPN-UHFFFAOYSA-N |
| SMILES | O=C1C=C(C2=CC(=O)c3ccccc3C2=O)C(=O)c2ccccc21 |
| HS Code | 2914399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Name: Induction of hydroxyl radicals generation assessed as methyl radical formation by mea...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4264781
|
|
Name: Induction of hydrogen peroxide-responsive hydroxyl radicals generation in human A549 ...
Source: ChEMBL
Target: A549
External Id: CHEMBL4264782
|
|
Name: Induction of hydroxyl radicals generation assessed as DMPO/hydroxyl radical level at ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4264788
|
|
Name: Induction of hydrogen peroxide-responsive hydroxyl radicals generation in human A549 ...
Source: ChEMBL
Target: A549
External Id: CHEMBL4264784
|
| 2,2'-Binaphthyl-1,4:1',4'-dichinon |
| 2,2'-dinaphthyl-1,4,1',4'-diquinone |
| 2,2'-binaphthyl-1,4:1',4'-diquinone |
| 2,2'-binaphthyl-1,4:1'4'-quinone |
| 2,2'-binaphthalenyl-1,4,1',4'-tetraone |
| 2,2'-bi-1,4-naphthoquinonyl |