b-D-Ribofuranuronic acid,1-(6-amino-9H-purin-9-yl)-1-deoxy- structure
|
Common Name | b-D-Ribofuranuronic acid,1-(6-amino-9H-purin-9-yl)-1-deoxy- | ||
|---|---|---|---|---|
| CAS Number | 3415-09-6 | Molecular Weight | 281.22500 | |
| Density | 2.24g/cm3 | Boiling Point | 756.3ºC at 760mmHg | |
| Molecular Formula | C10H11N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 411.2ºC | |
| Name | 9-riburonosyladenine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.24g/cm3 |
|---|---|
| Boiling Point | 756.3ºC at 760mmHg |
| Molecular Formula | C10H11N5O5 |
| Molecular Weight | 281.22500 |
| Flash Point | 411.2ºC |
| Exact Mass | 281.07600 |
| PSA | 156.61000 |
| Index of Refraction | 1.955 |
| InChIKey | IBYWUFHJUDTSOC-SOVPELCUSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(C(=O)O)C(O)C1O |
| WGK Germany | 3 |
|---|---|
| HS Code | 2934999090 |
|
~61%
b-D-Ribofuranur... CAS#:3415-09-6 |
| Literature: Debnath, Joy; Dasgupta, Swagata; Pathak, Tanmaya Bioorganic and Medicinal Chemistry, 2010 , vol. 18, # 23 p. 8257 - 8263 |
|
~%
b-D-Ribofuranur... CAS#:3415-09-6 |
| Literature: Olsson; Kusachi; Thompson; Ukena; Padgett; Daly Journal of medicinal chemistry, 1986 , vol. 29, # 9 p. 1683 - 1689 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CTK2H5807 |
| 2,4-DIOXO-2,4-DIHYDRO-1H-BENZO[D][1,3]OXAZINE-6-CARBOXYLIC ACID |
| 2,4-Dioxo-1,4-dihydro-2H-3,1-benzoxazine-6-carboxylic acid |
| 6-Carboxyisatosaeureanhydrid |
| ADENOSINE-5'-CARBOXYLIC ACID |
| 5'-Carboxyladenosine |
| 5-carboxyisatoic anhydride |
| 7-carboxyisatoic anhydride |
| 5'-oxyadenosine |
| adenosine 5'-carboxylic acid |
| 5-carboxylisatoic anhydride |