2',3'-O-Isopropylideneadenosine structure
|
Common Name | 2',3'-O-Isopropylideneadenosine | ||
|---|---|---|---|---|
| CAS Number | 362-75-4 | Molecular Weight | 307.31 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 570.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C13H17N5O4 | Melting Point | 221-222 °C(lit.) | |
| MSDS | N/A | Flash Point | 298.8±32.9 °C | |
Use of 2',3'-O-Isopropylideneadenosine2',3'-O-Isopropylideneadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 2',3'-O-Isopropylideneadenosine |
|---|---|
| Synonym | More Synonyms |
| Description | 2',3'-O-Isopropylideneadenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 570.5±60.0 °C at 760 mmHg |
| Melting Point | 221-222 °C(lit.) |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 |
| Flash Point | 298.8±32.9 °C |
| Exact Mass | 307.128052 |
| PSA | 117.54000 |
| LogP | 1.15 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.797 |
| InChIKey | LCCLUOXEZAHUNS-LCIRSVMXSA-N |
| SMILES | CC1(C)OC2C(CO)OC(n3cnc4c(N)ncnc43)C2O1 |
| Storage condition | Store at RT. |
| Safety Phrases | S22-S24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2',3'-O-(1-methylethylidene)adenosine |
| 9-(2,3-O-Isopropylidene-β-D-ribofuranosyl)adenine |
| 2',3'-O-Isopropylideneadenosine |
| 2,3-O-Isopropylideneadenosine |
| [(3aR,4R,6R,6aR)-6-(6-Amino-9H-purin-9-yl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methanol |
| 2',3'-ISOPROPYLIDENEADENOSINE |
| EINECS 206-650-3 |
| 2,3-Isopropylideneadeosine |
| 2’,3’-O-Isopropylideneadenosine |
| 2',3'-IPA |
| 2',3'-o-Isopropylideneadenosin |
| 2'-O,3'-O-Isopropylideneadenosine |
| MFCD00005756 |
| 2',3'-O-Isopropylidene-D-adenosine |
| ISOPROPYLIDENE ADENOSINE |
| 2',3'-O-isopropylidene-adenosine |
| 2‘,3‘-O-Isopropylideneadenosine |