6-(2-Hydroxyethyl)-2,2,5,7-tetramethyl-1-indanone structure
|
Common Name | 6-(2-Hydroxyethyl)-2,2,5,7-tetramethyl-1-indanone | ||
|---|---|---|---|---|
| CAS Number | 34169-69-2 | Molecular Weight | 232.318 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 394.2±41.0 °C at 760 mmHg | |
| Molecular Formula | C15H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.4±20.2 °C | |
| Name | Pterosin Z |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 394.2±41.0 °C at 760 mmHg |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.318 |
| Flash Point | 168.4±20.2 °C |
| Exact Mass | 232.146332 |
| PSA | 37.30000 |
| LogP | 3.19 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | YKQBHPHKXJKKAB-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(c(C)c1CCO)C(=O)C(C)(C)C2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914400090 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Cytotoxicity against human L02 cells assessed as effect on cell viability at 40 uM af...
Source: ChEMBL
Target: L02
External Id: CHEMBL4149568
|
| 2,3-Dihydro-6-(2-hydroxyethyl)-2,2,5,7-tetramethyl-1H-inden-1-one |
| 6-(2-Hydroxyethyl)-2,2,5,7-tetramethyl-1-indanone |