Lys-Bradykinin acetate salt structure
|
Common Name | Lys-Bradykinin acetate salt | ||
|---|---|---|---|---|
| CAS Number | 342-10-9 | Molecular Weight | 1188.38000 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C56H85N17O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lys-Bradykinin acetate saltLys-Bradykinin, a kind of kallidin and bradykinin receptor ligand, can be generated by kininogen protein through enzymatic cleavage by the protease kallikrein. Lys-Bradykinin, also a vasodilator, can widen blood vessels and increase blood flow. Lys-Bradykinin involves in vascular regulation, inflammation and pain sensation[1]. |
| Name | Lys-Bradykinin |
|---|---|
| Synonym | More Synonyms |
| Description | Lys-Bradykinin, a kind of kallidin and bradykinin receptor ligand, can be generated by kininogen protein through enzymatic cleavage by the protease kallikrein. Lys-Bradykinin, also a vasodilator, can widen blood vessels and increase blood flow. Lys-Bradykinin involves in vascular regulation, inflammation and pain sensation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C56H85N17O12 |
| Molecular Weight | 1188.38000 |
| Exact Mass | 1187.66000 |
| PSA | 468.90000 |
| LogP | 1.98630 |
| Index of Refraction | 1.685 |
| InChIKey | FYSKZKQBTVLYEQ-FSLKYBNLSA-N |
| SMILES | NCCCCC(N)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC(CO)C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| Kinin-10 |
| Substance DK |
| Kallidin II |
| Lys-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg |
| Bradykynin |
| KRPPGFSPFR |
| lysylbradykinin |
| Kallidin-10 |
| KALLIDIN |