L-Xylo-2-Hexulosonic Acid Hydrate structure
|
Common Name | L-Xylo-2-Hexulosonic Acid Hydrate | ||
|---|---|---|---|---|
| CAS Number | 342385-52-8 | Molecular Weight | 194.13900 | |
| Density | N/A | Boiling Point | 550.6ºC at 760mmHg | |
| Molecular Formula | C6H10O7 | Melting Point | 159-162ºC | |
| MSDS | N/A | Flash Point | 300.9ºC | |
| Name | 2-keto-l-gulonic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 550.6ºC at 760mmHg |
|---|---|
| Melting Point | 159-162ºC |
| Molecular Formula | C6H10O7 |
| Molecular Weight | 194.13900 |
| Flash Point | 300.9ºC |
| Exact Mass | 194.04300 |
| PSA | 135.29000 |
| Index of Refraction | 1.593 |
| InChIKey | VBUYCZFBVCCYFD-UZBSEBFBSA-N |
| SMILES | O=C(O)C(=O)C(O)C(O)C(O)CO |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00509044 |
| EINECS 208-403-5 |