4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide
4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide structure
|
Common Name | 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 34258-79-2 | Molecular Weight | 330.35800 | |
| Density | 1.497g/cm3 | Boiling Point | 490.5ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 490.5ºC at 760 mmHg |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.35800 |
| Flash Point | 250.5ºC |
| Exact Mass | 330.06700 |
| PSA | 98.58000 |
| LogP | 3.85420 |
| Index of Refraction | 1.701 |
| InChIKey | PGUHYTRMLNGOQQ-UHFFFAOYSA-N |
| SMILES | CN1C(C(=O)Nc2ccccc2)=C(O)c2ccccc2S1(=O)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![Ethyl 4-hydroxy-2-methyl-2H-benzo[e][1,2]thiazine-3-carboxylate 1,1-dioxide structure](https://image.chemsrc.com/caspic/482/24683-26-9.png)
![2-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)-6-((TRIMETHYLSILYL)ETHYNYL)FURO[3,2-B]PYRIDINE structure](https://image.chemsrc.com/caspic/210/24683-20-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-methyl-4-hydroxy-2H-1,2-benzothiazine-3-carboxanilide 1,1-dioxide |
| 2-methyl-4-hydroxy-2H-benzothiazine-3-carboxanilide 1,1-dioxide |
| 2H-1,2-Benzothiazine-3-carboxanilide,4-hydroxy-2-methyl-,1,1-dioxide |
| 2H-1,2-Benzothiazine-3-carboxamide,4-hydroxy-2-methyl-N-phenyl-,1,1-dioxide |
| 4-Hydroxy-2-methyl-N-phenyl-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide |
| W7477 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide? |
| A: Related upstream materials(CAS) of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide: 24683-26-9;6639-62-9;35511-14-9;81-07-2;24683-20-3;128-44-9;24683-21-4;35511-15-0. |
| Q: What is the boiling point of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide? |
| A: Boiling point of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide is 490.5ºC at 760 mmHg. |
| Q: What is the CAS number of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide? |
| A: CAS number of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide is 34258-79-2. |
| Q: What is the molecular formula of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide? |
| A: Molecular formula of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide is C16H14N2O4S. |
| Q: What is the polar surface area (PSA) of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide? |
| A: Polar surface area (PSA) of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide is 98.58000. |
| Q: What English synonyms does 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide have? |
| A: English synonyms of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide: 2-methyl-4-hydroxy-2H-1,2-benzothiazine-3-carboxanilide 1,1-dioxide, 2-methyl-4-hydroxy-2H-benzothiazine-3-carboxanilide 1,1-dioxide, 2H-1,2-Benzothiazine-3-carboxanilide,4-hydroxy-2-methyl-,1,1-dioxide, 2H-1,2-Benzothiazine-3-carboxamide,4-hydroxy-2-methyl-N-phenyl-,1,1-dioxide, 4-Hydroxy-2-methyl-N-phenyl-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide, W7477. |
| Q: What is the LogP of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide? |
| A: LogP of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide is 3.85420. |
| Q: What is the English name of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide? |
| A: The English name of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide is 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide. |
| Q: What is the InChIKey of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide? |
| A: InChIKey of 4-hydroxy-2-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide is PGUHYTRMLNGOQQ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 34258-79-2? |
| A: Chinese name of 34258-79-2 is 34258-79-2. |