L-Phe(3-OH)-OMe.Hcl structure
|
Common Name | L-Phe(3-OH)-OMe.Hcl | ||
|---|---|---|---|---|
| CAS Number | 34260-72-5 | Molecular Weight | 231.67600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-Phe(3-OH)-OMe.Hcl(S)-Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride is a phenylalanine derivative[1]. |
| Name | methyl (2S)-2-amino-3-(3-hydroxyphenyl)propanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Molecular Formula | C10H14ClNO3 |
|---|---|
| Molecular Weight | 231.67600 |
| Exact Mass | 231.06600 |
| PSA | 72.55000 |
| LogP | 1.93730 |
| InChIKey | WULJQXTZWBDFSE-FVGYRXGTSA-N |
| SMILES | COC(=O)C(N)Cc1cccc(O)c1.Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-m-hydroxyphenylalanine methyl ester hydrochloride |
| (S)-Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride |
| L-m-tyrosine methyl ester hydrochloride |
| (S)-m-tyrosine methyl ester hydrochloride |