1-(6-methoxy-2-prop-1-en-2-yl-1-benzofuran-5-yl)ethanone structure
|
Common Name | 1-(6-methoxy-2-prop-1-en-2-yl-1-benzofuran-5-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 34293-13-5 | Molecular Weight | 230.25900 | |
| Density | 1.108g/cm3 | Boiling Point | 348.2ºC at 760mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.4ºC | |
| Name | 1-(6-methoxy-2-prop-1-en-2-yl-1-benzofuran-5-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 348.2ºC at 760mmHg |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.25900 |
| Flash Point | 164.4ºC |
| Exact Mass | 230.09400 |
| PSA | 39.44000 |
| LogP | 3.67710 |
| Index of Refraction | 1.561 |
| InChIKey | XFSSPJGVPRWHLS-UHFFFAOYSA-N |
| SMILES | C=C(C)c1cc2cc(C(C)=O)c(OC)cc2o1 |
|
~82%
1-(6-methoxy-2-... CAS#:34293-13-5 |
| Literature: Morimoto, Masanori; Urakawa, Masamitsu; Fujitaka, Tatsuo; Komai, Koichiro Bioscience, Biotechnology and Biochemistry, 1999 , vol. 63, # 5 p. 840 - 846 |
|
~%
1-(6-methoxy-2-... CAS#:34293-13-5 |
| Literature: Kamthong; Robertson Journal of the Chemical Society, 1939 , p. 925,928 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-acetyl-2-isopropenyl-6-methoxy-benzofuran |
| 6-O-methyl-euparin |
| 6-methoxyeuparin |
| methyl euparin |