1,4,5,8-Tetrachloronaphthalene structure
|
Common Name | 1,4,5,8-Tetrachloronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 3432-57-3 | Molecular Weight | 265.95100 | |
| Density | 1.552g/cm3 | Boiling Point | 357.3ºC at 760mmHg | |
| Molecular Formula | C10H4Cl4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178ºC | |
| Name | 1,4,5,8-Tetrachloronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.552g/cm3 |
|---|---|
| Boiling Point | 357.3ºC at 760mmHg |
| Molecular Formula | C10H4Cl4 |
| Molecular Weight | 265.95100 |
| Flash Point | 178ºC |
| Exact Mass | 263.90700 |
| LogP | 5.45340 |
| Index of Refraction | 1.665 |
| InChIKey | LITCKAVLJAKHOE-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c2c(Cl)ccc(Cl)c12 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Naphthalene,1,4,5,8-tetrachloro |
| 1,4,5,8-tetrachloro-naphthalene |
| 1,4,5,8-Tetrachlor-naphthalin |