1,4,5,8-tetramethoxynaphthalene structure
|
Common Name | 1,4,5,8-tetramethoxynaphthalene | ||
|---|---|---|---|---|
| CAS Number | 10075-68-0 | Molecular Weight | 248.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1,4,5,8-Tetramethoxynaphthalene (CAS: 10075-68-0), molecular formula C14H16O4, molecular weight 248.27400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4,5,8-tetramethoxynaphthalene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16O4 |
|---|---|
| Molecular Weight | 248.27400 |
| Exact Mass | 248.10500 |
| PSA | 36.92000 |
| LogP | 2.87420 |
| InChIKey | SWNROPPWBFHVCS-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c2c(OC)ccc(OC)c12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 10 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Naphthalene,1,4,5,8-tetramethoxy |
| 1,4,5,8-Tetramethoxy-naphthalin |
| 1,4,5,8-tetramethoxy-naphthalene |
| Leukonaphthazarin-tetramethylaether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,4,5,8-tetramethoxynaphthalene? |
| A: Molecular weight of 1,4,5,8-tetramethoxynaphthalene is 248.27400. |
| Q: What English synonyms does 1,4,5,8-tetramethoxynaphthalene have? |
| A: English synonyms of 1,4,5,8-tetramethoxynaphthalene: Naphthalene,1,4,5,8-tetramethoxy, 1,4,5,8-Tetramethoxy-naphthalin, 1,4,5,8-tetramethoxy-naphthalene, Leukonaphthazarin-tetramethylaether. |
| Q: What is the SMILES notation of 1,4,5,8-tetramethoxynaphthalene? |
| A: SMILES notation of 1,4,5,8-tetramethoxynaphthalene is COc1ccc(OC)c2c(OC)ccc(OC)c12. |
| Q: What is the Chinese name of 10075-68-0? |
| A: Chinese name of 10075-68-0 is 10075-68-0. |
| Q: What is the InChIKey of 1,4,5,8-tetramethoxynaphthalene? |
| A: InChIKey of 1,4,5,8-tetramethoxynaphthalene is SWNROPPWBFHVCS-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,4,5,8-tetramethoxynaphthalene? |
| A: CAS number of 1,4,5,8-tetramethoxynaphthalene is 10075-68-0. |
| Q: What are the downstream products of 1,4,5,8-tetramethoxynaphthalene? |
| A: Related downstream products(CAS) of 1,4,5,8-tetramethoxynaphthalene: 475-38-7;14569-45-0;15013-16-8;71582-54-2;77386-93-7;88818-28-4;88818-30-8;88818-32-0;88818-33-1;88818-34-2. |
| Q: What is the English name of 1,4,5,8-tetramethoxynaphthalene? |
| A: The English name of 1,4,5,8-tetramethoxynaphthalene is 1,4,5,8-tetramethoxynaphthalene. |
| Q: What is the molecular formula of 1,4,5,8-tetramethoxynaphthalene? |
| A: Molecular formula of 1,4,5,8-tetramethoxynaphthalene is C14H16O4. |
| Q: What are the upstream materials of 1,4,5,8-tetramethoxynaphthalene? |
| A: Related upstream materials(CAS) of 1,4,5,8-tetramethoxynaphthalene: 88818-38-6;124-41-4;4988-51-6;77-78-1;67597-83-5;74-88-4;15013-16-8;150-78-7;14918-69-5;5690-27-7. |