4-(TERT-BUTOXY)-2,3,5,6-TETRAFLUOROSTYRENE structure
|
Common Name | 4-(TERT-BUTOXY)-2,3,5,6-TETRAFLUOROSTYRENE | ||
|---|---|---|---|---|
| CAS Number | 343305-41-9 | Molecular Weight | 248.21700 | |
| Density | 1.206g/cm3 | Boiling Point | 235ºC at 760 mmHg | |
| Molecular Formula | C12H12F4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 93.9ºC | |
| Name | 1-ethenyl-2,3,5,6-tetrafluoro-4-[(2-methylpropan-2-yl)oxy]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 235ºC at 760 mmHg |
| Molecular Formula | C12H12F4O |
| Molecular Weight | 248.21700 |
| Flash Point | 93.9ºC |
| Exact Mass | 248.08200 |
| PSA | 9.23000 |
| LogP | 4.06330 |
| Index of Refraction | 1.472 |
| InChIKey | QRKPOBGCHDVVRQ-UHFFFAOYSA-N |
| SMILES | C=Cc1c(F)c(F)c(OC(C)(C)C)c(F)c1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| pc3989 |