WAY-638778
Modify Date: 2025-10-04 17:02:12
WAY-638778 structure
|
Common Name | WAY-638778 | ||
|---|---|---|---|---|
| CAS Number | 343618-41-7 | Molecular Weight | 298.36 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 477.4±47.0 °C at 760 mmHg | |
| Molecular Formula | C16H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.5±29.3 °C | |
Use of WAY-638778inhibition of SHP2 phosphatase |
| Name | WAY-638778 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 477.4±47.0 °C at 760 mmHg |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.36 |
| Flash Point | 242.5±29.3 °C |
| Exact Mass | 298.077606 |
| LogP | 3.08 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | JHBIJHAYTQITKZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cn2c(=S)[nH]c3ccccc3c2=O)cc1 |
| MFCD02650955 |
| 3-(4-Methoxybenzyl)-2-thioxo-2,3-dihydro-4(1H)-quinazolinone |
| MFCD04046752 |
| 4(1H)-Quinazolinone, 2,3-dihydro-3-[(4-methoxyphenyl)methyl]-2-thioxo- |
| 2-mercapto-3-(4-methoxybenzyl)quinazolin-4(3H)-one |