5-Bromo-2-nitrobenzotrifluoride structure
|
Common Name | 5-Bromo-2-nitrobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 344-38-7 | Molecular Weight | 270.003 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 247.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H3BrF3NO2 | Melting Point | 33-35 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 103.7±27.3 °C | |
| Name | 5-Bromo-2-nitrobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 247.8±40.0 °C at 760 mmHg |
| Melting Point | 33-35 °C(lit.) |
| Molecular Formula | C7H3BrF3NO2 |
| Molecular Weight | 270.003 |
| Flash Point | 103.7±27.3 °C |
| Exact Mass | 268.929932 |
| PSA | 45.82000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | ZHLYHEDQTJZYFI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Br)cc1C(F)(F)F |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
5-Bromo-2-nitro... CAS#:344-38-7 |
| Literature: Journal of the American Chemical Society, , vol. 69, p. 2352 Journal of the American Chemical Society, , vol. 69, p. 2022 |
|
~%
5-Bromo-2-nitro... CAS#:344-38-7 |
| Literature: Journal of the American Chemical Society, , vol. 69, p. 2022 |
|
~%
5-Bromo-2-nitro... CAS#:344-38-7 |
| Literature: Journal of the American Chemical Society, , vol. 69, p. 2022 |
|
Fluorinated high-performance polymers: Poly (arylene ether) s and aromatic polyimides containing trifluoromethyl groups. Dhara MG and Banerjee S.
Prog. Polym. Sci. 35(8) , 1022-27, (2010)
|
| 2-NITRO-5-BROMOBENZOTRIFLUORID |
| 3-(trifluoromethyl)-4-nitrobromobenzene |
| 1-bromo-4-nitro-3-trifluoromethylbenzene |
| 4-nitro-3-trifluoromethylbromobenzene |
| 5-Bromo-2-nitro |
| 4-Bromo-1-nitro-2-(trifluoromethyl)benzene |
| 2-nitro-5-broMotrifluorotoluol |
| 2-NITRO-5-BROMOBENZOTRIFLUORIDE |
| MFCD00014706 |
| WNR DE BXFFF |
| 5-nitro-2-nitrobenzotrifluoride |
| 4-bromo-1-nitro-2-trifluoromethyl-benzene |
| 5-BroMo-2-nitro-trifluoroMethyl |
| Benzene, 4-bromo-1-nitro-2-(trifluoromethyl)- |
| 5-Bromo-2-nitro-α,α,α-trifluorotoluene |