N-ethyl-N-[2-[1-(2-methylpropoxy)ethoxy]ethyl]-4-(phenylazo)aniline structure
|
Common Name | N-ethyl-N-[2-[1-(2-methylpropoxy)ethoxy]ethyl]-4-(phenylazo)aniline | ||
|---|---|---|---|---|
| CAS Number | 34432-92-3 | Molecular Weight | 369.50000 | |
| Density | 1.02g/cm3 | Boiling Point | 488.9ºC at 760mmHg | |
| Molecular Formula | C22H31N3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 249.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-ethyl-N-[2-[1-(2-methylpropoxy)ethoxy]ethyl]-4-phenyldiazenylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 488.9ºC at 760mmHg |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.50000 |
| Flash Point | 249.5ºC |
| Exact Mass | 369.24200 |
| PSA | 46.42000 |
| LogP | 5.96350 |
| Index of Refraction | 1.529 |
| InChIKey | BATVZJPOLFSGTD-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(C)OCC(C)C)c1ccc(N=Nc2ccccc2)cc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H413 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| Sudan 455 |
| Solvent yellow 124 |
| SY124 |
| C.I. Solvent Yellow 124 |
| T10 Yellow LBN |
| EINECS 252-021-1 |
| Somalia Yellow |
| N-Ethyl-N-[2-(1-isobutoxyethoxy)ethyl]-p-(phenylazo)aniline |