(2-Chloro-4-nitrophenyl)(2-methylphenyl)methanone structure
|
Common Name | (2-Chloro-4-nitrophenyl)(2-methylphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 344459-21-8 | Molecular Weight | 275.68700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-Chloro-4-nitrophenyl)(2-methylphenyl)methanone |
|---|
| Molecular Formula | C14H10ClNO3 |
|---|---|
| Molecular Weight | 275.68700 |
| Exact Mass | 275.03500 |
| PSA | 62.89000 |
| LogP | 4.31080 |
| InChIKey | HOYBLYICPHKGPO-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)c1ccc([N+](=O)[O-])cc1Cl |
|
~75%
(2-Chloro-4-nit... CAS#:344459-21-8 |
| Literature: Ottosen, Erik Rytter; Sorensen, Morten Dahl; Bjoerkling, Fredrik; Skak-Nielsen, Tine; Fjording, Marianne Scheel; Aaes, Helle; Binderup, Lise Journal of Medicinal Chemistry, 2003 , vol. 46, # 26 p. 5651 - 5662 |
|
~%
(2-Chloro-4-nit... CAS#:344459-21-8 |
| Literature: Ottosen, Erik Rytter; Sorensen, Morten Dahl; Bjoerkling, Fredrik; Skak-Nielsen, Tine; Fjording, Marianne Scheel; Aaes, Helle; Binderup, Lise Journal of Medicinal Chemistry, 2003 , vol. 46, # 26 p. 5651 - 5662 |