2-Chloro-4-nitrobenzoic acid structure
|
Common Name | 2-Chloro-4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 99-60-5 | Molecular Weight | 201.564 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 362.2±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClNO4 | Melting Point | 136-140 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 172.8±23.7 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-Chloro-4-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 362.2±27.0 °C at 760 mmHg |
| Melting Point | 136-140 °C(lit.) |
| Molecular Formula | C7H4ClNO4 |
| Molecular Weight | 201.564 |
| Flash Point | 172.8±23.7 °C |
| Exact Mass | 200.982880 |
| PSA | 83.12000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | QAYNSPOKTRVZRC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1Cl |
| Water Solubility | 1 g/L (20 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H318-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DG5425000 |
| HS Code | 2942000000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Inhibition of Mycobacterium tuberculosis salicylate synthase expressed in Escherichia...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4156197
|
| Benzoic acid,2-chloro-4-nitro |
| 2-chloro-para-nitrobenzoic acid |
| 2-chloro-4-nitro-benzoic acid |
| 4-nitro-2-chlorobenzoic acid |
| MFCD00007209 |
| EINECS 202-771-0 |
| 2-Chloro-4-nitrobenzoic acid |
| 2-Chlor-4-nitro-benzoesaeure |
| Kyselina 2-chloro-4-nitrobenzoova |