1-Butyl-3-methylimidazolium thiocyanate structure
|
Common Name | 1-Butyl-3-methylimidazolium thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 344790-87-0 | Molecular Weight | 197.301 | |
| Density | 1.07 g/mL at 25 °C | Boiling Point | N/A | |
| Molecular Formula | C9H15N3S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 207ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-butyl-3-methylimidazol-3-ium,thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07 g/mL at 25 °C |
|---|---|
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.301 |
| Flash Point | 207ºC |
| Exact Mass | 197.098663 |
| PSA | 32.60000 |
| LogP | 1.12708 |
| Index of Refraction | n20/D1.538 |
| InChIKey | SIXHYMZEOJSYQH-UHFFFAOYSA-M |
| SMILES | CCCCn1cc[n+](C)c1.N#C[S-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H412 |
| Supplemental HS | Contact with acids liberates very toxic gas. |
| Precautionary Statements | P273-P280 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/21/22;R32;R52/53 |
| Safety Phrases | 13-61 |
| RIDADR | UN 2810 |
| WGK Germany | 2 |
| Hazard Class | 6.1 |
| HS Code | 2933290090 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Single-step preparation of two-dimensionally organized gold particles via ionic liquid/metal sputter deposition.
Phys. Chem. Chem. Phys. 17 , 13150-9, (2015) Sputtering of noble metals, such as Au, Ag, Pd, and Pt, onto room-temperature ionic liquids (RTILs) enabled the formation of monoparticle films composed of spherical noble metal nanoparticles on the l... |
| 1-butyl-3-methyl-3H-imidazolium thiocyanate |
| 1-Butyl-3-methylimidazolium thiocyanate |
| 1-Butyl-3-methyl-1H-imidazol-3-ium thiocyanate |
| BASIONIC VS 02 |
| MFCD06798181 |
| 1-n-butyl-3-methyl-imidazolium thiocyanate |