1-dibenzylamino-2-methyl-propan-2-ol structure
|
Common Name | 1-dibenzylamino-2-methyl-propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 344868-41-3 | Molecular Weight | 269.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-dibenzylamino-2-methyl-propan-2-ol |
|---|
| Molecular Formula | C18H23NO |
|---|---|
| Molecular Weight | 269.38100 |
| Exact Mass | 269.17800 |
| PSA | 23.47000 |
| LogP | 3.45970 |
| InChIKey | HVJBYNVLUYHGFU-UHFFFAOYSA-N |
| SMILES | CC(C)(O)CN(Cc1ccccc1)Cc1ccccc1 |
|
~%
1-dibenzylamino... CAS#:344868-41-3 |
| Literature: Kerwin et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 2961,2965 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |