1-(4-FLUORO-PHENYL)-2-METHYL-PROPAN-2-OL structure
|
Common Name | 1-(4-FLUORO-PHENYL)-2-METHYL-PROPAN-2-OL | ||
|---|---|---|---|---|
| CAS Number | 7397-22-0 | Molecular Weight | 242.24500 | |
| Density | 1.258g/cm3 | Boiling Point | 405.9ºC at 760 mmHg | |
| Molecular Formula | C15H11FO2 | Melting Point | 189-190ºC | |
| MSDS | N/A | Flash Point | 199.3ºC | |
| Name | (E)-1-(4-fluorophenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 405.9ºC at 760 mmHg |
| Melting Point | 189-190ºC |
| Molecular Formula | C15H11FO2 |
| Molecular Weight | 242.24500 |
| Flash Point | 199.3ºC |
| Exact Mass | 242.07400 |
| PSA | 37.30000 |
| LogP | 3.42740 |
| Index of Refraction | 1.635 |
| InChIKey | APSLSSPGSTXOJC-XCVCLJGOSA-N |
| SMILES | O=C(C=Cc1ccc(O)cc1)c1ccc(F)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| fluorophenylhydroxyphenylpropenone |
| JS-080C |
| 1-(4-Fluorophenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| 4-hydroxyl-4'-fluorochalcone |
| (2E)-1-(4-fluorophenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| 4'-Fluor-4-hydroxy-chalkon |