5-(Trifluoromethyl)isatin structure
|
Common Name | 5-(Trifluoromethyl)isatin | ||
|---|---|---|---|---|
| CAS Number | 345-32-4 | Molecular Weight | 215.129 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H4F3NO2 | Melting Point | 246 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(trifluoromethyl)-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | 246 °C |
| Molecular Formula | C9H4F3NO2 |
| Molecular Weight | 215.129 |
| Exact Mass | 215.019409 |
| PSA | 46.17000 |
| LogP | 1.13 |
| Index of Refraction | 1.513 |
| InChIKey | WODYULWWVAMDCP-UHFFFAOYSA-N |
| SMILES | O=C1Nc2ccc(C(F)(F)F)cc2C1=O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~%
5-(Trifluoromet... CAS#:345-32-4 |
| Literature: Journal of the American Chemical Society, , vol. 73, p. 3579 |
|
~%
5-(Trifluoromet... CAS#:345-32-4 |
| Literature: US5565483 A1, ; US 5565483 A |
|
~%
5-(Trifluoromet... CAS#:345-32-4 |
| Literature: Journal of the American Chemical Society, , vol. 73, p. 3579 |
|
~%
5-(Trifluoromet... CAS#:345-32-4 |
| Literature: Tetrahedron Letters, , vol. 35, # 40 p. 7303 - 7306 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Trifluormethyl-indolin-2,3-dion |
| T56 BMVVJ GXFFF |
| 5-trifluoromethylisatin |
| 5-(Trifluoromethyl)isatin |
| 5-trifluoromethyl-indole-2,3-dione |
| MFCD01569510 |
| 5-(Trifluoromethyl)-1H-indole-2,3-dione |
| 1H-Indole-2,3-dione, 5-(trifluoromethyl)- |