5-[(4-methoxyphenyl)methylidene]cyclopent-2-ene-1,4-dione structure
|
Common Name | 5-[(4-methoxyphenyl)methylidene]cyclopent-2-ene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 34506-76-8 | Molecular Weight | 214.21700 | |
| Density | 1.284g/cm3 | Boiling Point | 431.7ºC at 760 mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.4ºC | |
| Name | 2-[(4-methoxyphenyl)methylidene]cyclopent-4-ene-1,3-dione |
|---|
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 431.7ºC at 760 mmHg |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Flash Point | 196.4ºC |
| Exact Mass | 214.06300 |
| PSA | 43.37000 |
| LogP | 1.78660 |
| Index of Refraction | 1.642 |
| InChIKey | WIHYHPSLMHNCBZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=C2C(=O)C=CC2=O)cc1 |
|
~31%
5-[(4-methoxyph... CAS#:34506-76-8 |
| Literature: Tichotova, Lucie; Matousova, Eliska; Spulak, Marcel; Kunes, Jiri; Votruba, Ivan; Buchta, Vladimir; Pour, Milan Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 20 p. 6062 - 6066 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |