ethyl 2-(4-chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetate structure
|
Common Name | ethyl 2-(4-chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 345237-74-3 | Molecular Weight | 270.63600 | |
| Density | 1.42g/cm3 | Boiling Point | 298.9ºC at 760 mmHg | |
| Molecular Formula | C9H10ClF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.6ºC | |
| Name | Ethyl [4-chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 298.9ºC at 760 mmHg |
| Molecular Formula | C9H10ClF3N2O2 |
| Molecular Weight | 270.63600 |
| Flash Point | 134.6ºC |
| Exact Mass | 270.03800 |
| PSA | 44.12000 |
| LogP | 2.42680 |
| Index of Refraction | 1.491 |
| InChIKey | HUNTWKCKPLUKBV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1nc(C(F)(F)F)c(Cl)c1C |
| HS Code | 2933199090 |
|---|
|
~84%
ethyl 2-(4-chlo... CAS#:345237-74-3 |
| Literature: ChemoCentryx, Inc.; Chen, Xi; Dragoli, Dean R.; Fan, Pingchen; Li, Yandong; Powers, Jay P.; Punna, Sreenivas; Tanaka, Hiroko; Zhang, Penglie Patent: US2014/57937 A1, 2014 ; Location in patent: Paragraph 0093; 0094 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4-chloro-2-methylsulfanyl-pyrimidin-5-yl)-acetic acid ethyl ester |
| 4-Chlor-5-ethoxycarbonylmethyl-2-methylmercapto-pyrimidin |
| ETHYL 2-(4-CHLORO-2-(METHYLTHIO)PYRIMIDIN-5-YL)ACETATE |
| ethyl 2-(4-chloro-2-methylsulfanyl-pyrimidin-5-yl)acetate |
| ethyl [4-chloro-2-(methylthio)pyrimidin-5-yl]acetate |
| ethyl 2-(4-chloro-5-methyl-3-(trifluoromethyl)-1H-pyrazol-1-yl)acetate |
| MFCD01527957 |
| (4-Chloro-5-methyl-3-trifluoromethyl-pyrazol-1-yl)-acetic acid ethyl ester |
| 1H-Pyrazole-1-acetic acid, 4-chloro-5-methyl-3-(trifluoromethyl)-, ethyl ester |