(4-Chloro-5-Methyl-3-Trifluoromethyl-Pyrazol-1-Yl)-Acetic Acid
Modify Date: 2025-09-18 10:35:41
(4-Chloro-5-Methyl-3-Trifluoromethyl-Pyrazol-1-Yl)-Acetic Acid structure
|
Common Name | (4-Chloro-5-Methyl-3-Trifluoromethyl-Pyrazol-1-Yl)-Acetic Acid | ||
|---|---|---|---|---|
| CAS Number | 378758-70-4 | Molecular Weight | 242.58300 | |
| Density | N/A | Boiling Point | 335.3ºC at 760mmHg | |
| Molecular Formula | C7H6ClF3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 335.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H6ClF3N2O2 |
| Molecular Weight | 242.58300 |
| Flash Point | 156.6ºC |
| Exact Mass | 242.00700 |
| PSA | 55.12000 |
| LogP | 1.94830 |
| Index of Refraction | 1.521 |
| InChIKey | IZBZQUREHISXFJ-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1CC(=O)O |
| HS Code | 2933199090 |
|---|
|
~87%
(4-Chloro-5-Met... CAS#:378758-70-4 |
| Literature: US2014/57937 A1, ; Paragraph 0093; 0095 ; |
|
~%
(4-Chloro-5-Met... CAS#:378758-70-4 |
| Literature: US2014/57937 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4-Chloro-5-Methyl-3-Trifluoromethyl-Pyrazol-1-Yl)-Acetic Acid |
| 2-[4-Chloro-5-Methyl-3-(Trifluoromethyl)-1-Pyrazolyl]Acetate |
| 2-[4-Chloro-5-Methyl-3-(Trifluoromethyl)Pyrazol-1-Yl]Ethanoate |
| Zinc02248322 |