CHEMBRDG-BB 5678493 structure
|
Common Name | CHEMBRDG-BB 5678493 | ||
|---|---|---|---|---|
| CAS Number | 345637-67-4 | Molecular Weight | 264.03400 | |
| Density | 2.06g/cm3 | Boiling Point | 422.1ºC at 760 mmHg | |
| Molecular Formula | C6H6BrN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | (4-Bromo-5-methyl-3-nitro-1H-pyrazol-1-yl)-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.06g/cm3 |
|---|---|
| Boiling Point | 422.1ºC at 760 mmHg |
| Molecular Formula | C6H6BrN3O4 |
| Molecular Weight | 264.03400 |
| Flash Point | 209.1ºC |
| Exact Mass | 262.95400 |
| PSA | 100.94000 |
| LogP | 1.47000 |
| Index of Refraction | 1.699 |
| InChIKey | JUGOZTZNWGFYHL-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)c([N+](=O)[O-])nn1CC(=O)O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)acetic acid |