3-hydroxydodecanedioic acid structure
|
Common Name | 3-hydroxydodecanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 34574-69-1 | Molecular Weight | 246.30000 | |
| Density | 1.152g/cm3 | Boiling Point | 456.2ºC at 760mmHg | |
| Molecular Formula | C12H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.8ºC | |
| Name | 3-hydroxydodecanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 456.2ºC at 760mmHg |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30000 |
| Flash Point | 243.8ºC |
| Exact Mass | 246.14700 |
| PSA | 94.83000 |
| LogP | 2.02740 |
| InChIKey | FYVQCLGZFXHEGL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCCC(O)CC(=O)O |
| HS Code | 2918199090 |
|---|
|
~%
3-hydroxydodeca... CAS#:34574-69-1 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 90, p. 1331 - 1332 |
|
~%
3-hydroxydodeca... CAS#:34574-69-1 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 90, p. 1331 - 1332 |
|
~%
3-hydroxydodeca... CAS#:34574-69-1 |
| Literature: Recueil des Travaux Chimiques des Pays-Bas, , vol. 90, p. 1331 - 1332 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Hydroxydodecanedioicacid |
| 3-Hydroxy-dodecandisaeure-(1,12) |
| 3-Hydroxydodecanedioate |
| Dodecanedioic acid,3-hydroxy |