2-(benzo[d]thiazol-2-yl)-2-(2-chloropyrimidin-4-yl)acetonitrile structure
|
Common Name | 2-(benzo[d]thiazol-2-yl)-2-(2-chloropyrimidin-4-yl)acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 345986-38-1 | Molecular Weight | 286.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7ClN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-(benzo[d]thiazol-2-yl)-2-(2-chloropyrimidin-4-yl)acetonitrileJNK-IN-13 (compound 1) is a potent and selective JNK inhibitor with IC50s of 290 nM and 500 nM for JNK3 and JNK2, respectively[1]. |
| Name | 1,3-Benzothiazol-2-yl(2-chloro-4-pyrimidinyl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | JNK-IN-13 (compound 1) is a potent and selective JNK inhibitor with IC50s of 290 nM and 500 nM for JNK3 and JNK2, respectively[1]. |
|---|---|
| Related Catalog | |
| Target |
JNK2:500 nM (IC50) JNK3:290 nM (IC50) |
| References |
[1]. Serge Halazy, et al. Benzazole derivatives and their use as JNK modulators. EP1110957A1. |
| Molecular Formula | C13H7ClN4S |
|---|---|
| Molecular Weight | 286.74 |
| Exact Mass | 286.00800 |
| PSA | 90.70000 |
| LogP | 3.39518 |
| InChIKey | QVMKLKBODZHJDK-UHFFFAOYSA-N |
| SMILES | N#CC(c1ccnc(Cl)n1)c1nc2ccccc2s1 |
|
~84%
2-(benzo[d]thia... CAS#:345986-38-1 |
| Literature: ARES TRADING S.A. Patent: US2008/51397 A1, 2008 ; Location in patent: Page/Page column 21 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzothiazole,2-[(phenylmethyl)sulfonyl] |
| 2-phenylmethanesulfonyl-benzothiazole |
| 1,3-benzothiazol-2-yl(2-chloro-4-pyrimidinyl)-acetonitrile |
| 2-Phenylmethansulfonyl-benzothiazol |
| 1,3-benzothiazol-2-yl benzyl sulfone |
| benzothiazol-2-yl-(2-chloro-pyrimidin-4-yl)-acetonitrile |
| 2-<(phenylmethyl)sulfonyl>benzothiazole |
| 2-(benzylsulfonyl)benzothiazole |
| benzothiazol-2-benzyl sulfone |
| 2-(benzylsulfonyl)benzo[d]thiazole |