3,3'-bis(trifluoromethyl)benzidine structure
|
Common Name | 3,3'-bis(trifluoromethyl)benzidine | ||
|---|---|---|---|---|
| CAS Number | 346-88-3 | Molecular Weight | 320.23300 | |
| Density | 1.415g/cm3 | Boiling Point | 364.2ºC at 760 mmHg | |
| Molecular Formula | C14H10F6N2 | Melting Point | 180-181ºC | |
| MSDS | N/A | Flash Point | 165.5ºC | |
| Name | 4-[4-amino-3-(trifluoromethyl)phenyl]-2-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 364.2ºC at 760 mmHg |
| Melting Point | 180-181ºC |
| Molecular Formula | C14H10F6N2 |
| Molecular Weight | 320.23300 |
| Flash Point | 165.5ºC |
| Exact Mass | 320.07500 |
| PSA | 52.04000 |
| LogP | 5.71800 |
| Index of Refraction | 1.524 |
| InChIKey | PJWQLRKRVISYPL-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2ccc(N)c(C(F)(F)F)c2)cc1C(F)(F)F |
| Hazard Codes | T,Xi |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | 22-36/37/39-45 |
| RIDADR | UN 2811 |
| HS Code | 2921590090 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3'-Bistrifluormethylbenzidin |
| PC3086M |
| MFCD00236672 |