2,6-bis(tert-butyl)-4-(1-methyl-1-phenylethyl)phenol structure
|
Common Name | 2,6-bis(tert-butyl)-4-(1-methyl-1-phenylethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 34624-81-2 | Molecular Weight | 324.50000 | |
| Density | 0.97g/cm3 | Boiling Point | 371.4ºC at 760mmHg | |
| Molecular Formula | C23H32O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.8ºC | |
| Name | 2,6-ditert-butyl-4-(2-phenylpropan-2-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 371.4ºC at 760mmHg |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.50000 |
| Flash Point | 168.8ºC |
| Exact Mass | 324.24500 |
| PSA | 20.23000 |
| LogP | 6.31310 |
| Index of Refraction | 1.528 |
| InChIKey | ROEHFIIRMUXFRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)c2ccccc2)cc(C(C)(C)C)c1O |
| HS Code | 2907199090 |
|---|
|
~%
2,6-bis(tert-bu... CAS#:34624-81-2 |
| Literature: Prasain, Keshar; Nguyen, Thi D.T.; Gorman, Maureen J.; Barrigan, Lydia M.; Peng, Zeyu; Kanost, Michael R.; Syed, Lateef U.; Li, Jun; Zhu, Kun Yan; Hua, Duy H. Bioorganic and Medicinal Chemistry, 2012 , vol. 20, # 5 p. 1679 - 1689 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,6-di-tert.-butyl-4-cumyl phenol |
| 2-<4-Hydroxy-3.5-di-tert-butyl-phenyl>-2-phenyl-propan |
| Mon 0585 |
| 2.6-Di-tert-butyl-4-<1-methyl-1-phenyl-aethyl>-phenol |