2-[2-(4-butan-2-yl-2-chlorophenoxy)-5-methylphenyl]acetic acid structure
|
Common Name | 2-[2-(4-butan-2-yl-2-chlorophenoxy)-5-methylphenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 34643-12-4 | Molecular Weight | 332.82100 | |
| Density | 1.179g/cm3 | Boiling Point | 426.6ºC at 760 mmHg | |
| Molecular Formula | C19H21ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.8ºC | |
| Name | 2-[2-(4-butan-2-yl-2-chlorophenoxy)-5-methylphenyl]acetic acid |
|---|
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 426.6ºC at 760 mmHg |
| Molecular Formula | C19H21ClO3 |
| Molecular Weight | 332.82100 |
| Flash Point | 211.8ºC |
| Exact Mass | 332.11800 |
| PSA | 46.53000 |
| LogP | 5.58130 |
| Index of Refraction | 1.568 |
| InChIKey | GXEMWUSHSIBTJU-UHFFFAOYSA-N |
| SMILES | CCC(C)c1ccc(Oc2ccc(C)cc2CC(=O)O)c(Cl)c1 |
|
~%
2-[2-(4-butan-2... CAS#:34643-12-4 |
| Literature: Atkinson, David C.; Godfrey, Keith E.; Meek, Bernard; Saville, John F.; Stillings, Michael R. Journal of Medicinal Chemistry, 1983 , vol. 26, # 10 p. 1353 - 1360 |
|
~%
2-[2-(4-butan-2... CAS#:34643-12-4 |
| Literature: Reckitt and Colman Patent: DE2117826 , 1971 ; Chem.Abstr., 1972 , vol. 76, # 14110 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |