Cyperenone structure
|
Common Name | Cyperenone | ||
|---|---|---|---|---|
| CAS Number | 3466-15-7 | Molecular Weight | 218.33500 | |
| Density | 1.03±0.1 g/cm3 | Boiling Point | 318.7±9.0℃ at 760 mmHg | |
| Molecular Formula | C15H22O | Melting Point | 48 ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of CyperenoneCyperotundone is a sesquiterpene isolated from Nagarmotha (Cyperus rotundus)[1][2]. |
| Name | α-cyperotundone |
|---|---|
| Synonym | More Synonyms |
| Description | Cyperotundone is a sesquiterpene isolated from Nagarmotha (Cyperus rotundus)[1][2]. |
|---|---|
| Related Catalog | |
| References |
[1]. Hashmat Imam, et al. The incredible benefits of Nagarmotha (Cyperus rotundus). 2014, 4(1): 23-27. |
| Density | 1.03±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.7±9.0℃ at 760 mmHg |
| Melting Point | 48 ºC |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.33500 |
| Exact Mass | 218.16700 |
| PSA | 17.07000 |
| LogP | 3.73810 |
| InChIKey | GIGKXOAUYMWORB-OSQNNJELSA-N |
| SMILES | CC1=C2CC3CCC(C)C2(CC1=O)C3(C)C |
| Storage condition | 2-8℃ |
| Water Solubility | Practically insoluble (0.061 g/L) (25 ºC) |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (3aR)-1,4t,9,9-tetramethyl-5,6,7,8-tetrahydro-4H-3ar,7c-methano-azulen-2-one |
| cyperotundone |
| (3aR)-1,4t,9,9-Tetramethyl-5,6,7,8-tetrahydro-4H-3ar,7c-methano-azulen-2-on |
| Cyperenone |