5-Chloro-2-nitrobenzonitrile structure
|
Common Name | 5-Chloro-2-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 34662-31-2 | Molecular Weight | 182.56400 | |
| Density | 1.47g/cm3 | Boiling Point | 313ºC at 760mmHg | |
| Molecular Formula | C7H3ClN2O2 | Melting Point | 89-91 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 143.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Chloro-2-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 313ºC at 760mmHg |
| Melting Point | 89-91 °C(lit.) |
| Molecular Formula | C7H3ClN2O2 |
| Molecular Weight | 182.56400 |
| Flash Point | 143.1ºC |
| Exact Mass | 181.98800 |
| PSA | 69.61000 |
| LogP | 2.64308 |
| Index of Refraction | 1.599 |
| InChIKey | HPWJUEZFOUOUEO-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(Cl)ccc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2926909090 |
|
~87%
5-Chloro-2-nitr... CAS#:34662-31-2 |
| Literature: Moussa, Ziad; Ahmed, Saleh A.; ElDouhaibi, Ahmad S.; Al-Raqa, Shaya Y. Tetrahedron Letters, 2010 , vol. 51, # 14 p. 1826 - 1831 |
|
~%
5-Chloro-2-nitr... CAS#:34662-31-2 |
| Literature: US4959487 A1, ; |
|
~%
5-Chloro-2-nitr... CAS#:34662-31-2 |
| Literature: Tetrahedron, , vol. 50, # 18 p. 5515 - 5525 |
|
~%
5-Chloro-2-nitr... CAS#:34662-31-2 |
| Literature: Tetrahedron, , vol. 50, # 18 p. 5515 - 5525 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Folate antagonists. 12. Antimalarial and antibacterial effects of 2,4-diamino-6-[(aralkyl and alicyclid)thio-, sulfinyl-, and sulfonyl]quinazolines.
J. Med. Chem. 21(7) , 639-43, (1978) A series of 2,4-diamino-6-[(aralkyl and alicyclic)thio-, sulfinyl-, and sulfonyl]quinazolines was prepared via condensation of 5-chloro-2-nitrobenzonitrile or 5,6-dichloro-2-nitrobenzonitrile with the... |
| 2-Nitro-5-chlor-benzonitril |
| 3-Chlor-6-nitrobenzonitril |
| 5-chloro-2-nitrobenzenecarbonitrile |
| Benzonitrile,5-chloro-2-nitro |
| EINECS 252-132-5 |
| 3-Chloro-6-nitrobenzonitrile |
| 2-Nitro-5-chlorobenzonitrile |
| 5-Chlor-2-nitrobenzonitril |
| MFCD00007286 |
| 5-chloro-2-nitro-benzonitrile |