4-(5-Nitro-pyridin-2-yloxy)-piperidine-1-carboxylicacidtert-butylester structure
|
Common Name | 4-(5-Nitro-pyridin-2-yloxy)-piperidine-1-carboxylicacidtert-butylester | ||
|---|---|---|---|---|
| CAS Number | 346665-40-5 | Molecular Weight | 323.34400 | |
| Density | 1.247 | Boiling Point | N/A | |
| Molecular Formula | C15H21N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 4-(5-nitropyridin-2-yl)oxypiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.247 |
|---|---|
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.34400 |
| Exact Mass | 323.14800 |
| PSA | 97.48000 |
| LogP | 3.22920 |
| InChIKey | JVQMZHDBFJVUEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc([N+](=O)[O-])cn2)CC1 |
| HS Code | 2933990090 |
|---|
|
~73%
4-(5-Nitro-pyri... CAS#:346665-40-5 |
| Literature: ELI LILLY AND COMPANY Patent: WO2007/53394 A1, 2007 ; Location in patent: Page/Page column 20 ; WO 2007/053394 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-(5-nitro-2-pyridyloxy)piperidinecarboxylate |
| 4-(5-nitro-pyridin-2-yloxy)-piperidine-1-carboxylic acid tert-butyl ester |
| tert-Butyl 4-((5-nitropyridin-2-yl)oxy)piperidine-1-carboxylate |