3,5-dimethylphenylmagnesium bromide structure
|
Common Name | 3,5-dimethylphenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 34696-73-6 | Molecular Weight | 209.36600 | |
| Density | 0.950 g/mL at 25 °C | Boiling Point | 65 °C | |
| Molecular Formula | C8H9BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,1,3-dimethylbenzene-5-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.950 g/mL at 25 °C |
|---|---|
| Boiling Point | 65 °C |
| Molecular Formula | C8H9BrMg |
| Molecular Weight | 209.36600 |
| Flash Point | 1 °F |
| Exact Mass | 207.97400 |
| LogP | 2.94920 |
| Appearance of Characters | Liquid | Yellow to brown |
| InChIKey | UWIBIDGHIMGNRC-UHFFFAOYSA-M |
| SMILES | Cc1c[c-]cc(C)c1.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Water Solubility | It reacts with water. |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-26-33-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| Hazard Class | 3.0 |
| HS Code | 2931900090 |
|
~%
3,5-dimethylphe... CAS#:34696-73-6 |
| Literature: Journal of the American Chemical Society, , vol. 109, # 10 p. 3098 - 3107 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 3,5-Dimethylphenylmagnesium bromide |
| MFCD01311497 |
| 3,5-Dimethylphenylmagnesium bromide solution |
| m-xylylMgBr |
| 3,5-Dimethylphenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| 3,5-dimethyphenylmagnesium bromide |
| 3,5-Me2C6H3MgBr |