2,2,2-trifluoro-N-(4-phenylphenyl)acetamide
Modify Date: 2025-08-27 12:25:24
2,2,2-trifluoro-N-(4-phenylphenyl)acetamide structure
|
Common Name | 2,2,2-trifluoro-N-(4-phenylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 347-37-5 | Molecular Weight | 265.23100 | |
| Density | 1.298g/cm3 | Boiling Point | 370.8ºC at 760 mmHg | |
| Molecular Formula | C14H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.1ºC | |
| Name | N-([1,1'-biphenyl]-4-yl)-2,2,2-trifluoroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 370.8ºC at 760 mmHg |
| Molecular Formula | C14H10F3NO |
| Molecular Weight | 265.23100 |
| Flash Point | 178.1ºC |
| Exact Mass | 265.07100 |
| PSA | 29.10000 |
| LogP | 3.92740 |
| Index of Refraction | 1.555 |
| InChIKey | UEZRDXDUQAKINL-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)C(F)(F)F |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:3365-81-9|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 5, Current Page 1 of 1
1
| 4-Trifluoroacetylaminobiphenyl |
| 1H-Pyrrole-2,5-dione,1-(4-phenylbutyl) |
| 1-(4-phenybutyl)maleimide |
| 1-(4-Phenylbutyl)Maleimide |
| N-4-Diphenyl-trifluoracetamid |
| N-(biphenyl-4-yl)-2,2,2-trifluoro-acetamide |
| N-(4-Phenyl-n-butyl)-maleinsaeureimid |
| Trifluor-essigsaeure-biphenyl-4-ylamid |
| trifluoro-acetic acid biphenyl-4-ylamide |
| N-(4-phenylphenyl)trifluoroacetamide |
| 2,2,2-trifluoro-4'-phenylacetanilide |