WAY-311669 structure
|
Common Name | WAY-311669 | ||
|---|---|---|---|---|
| CAS Number | 347316-73-8 | Molecular Weight | 409.5 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 590.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C23H23NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.6±30.1 °C | |
Use of WAY-311669inhibiting beta-amyloid production |
| Name | WAY-311669 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 590.0±50.0 °C at 760 mmHg |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.5 |
| Flash Point | 310.6±30.1 °C |
| Exact Mass | 409.134766 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | DFTXUMHPBHOBGD-UHFFFAOYSA-N |
| SMILES | COc1ccc(COC(=O)C2=C(C)NC3=C(C(=O)CCC3)C2c2cccs2)cc1 |
| 4-Methoxybenzyl 2-methyl-5-oxo-4-(2-thienyl)-1,4,5,6,7,8-hexahydro-3-quinolinecarboxylate |
| 4-Methoxybenzyl 2-methyl-5-oxo-4-(2-thienyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| 3-Quinolinecarboxylic acid, 1,4,5,6,7,8-hexahydro-2-methyl-5-oxo-4-(2-thienyl)-, (4-methoxyphenyl)methyl ester |