1-(5-((5-Acetyl-2-thienyl)methyl)-2-thienyl)ethanone structure
|
Common Name | 1-(5-((5-Acetyl-2-thienyl)methyl)-2-thienyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 34768-06-4 | Molecular Weight | 264.36300 | |
| Density | 1.253g/cm3 | Boiling Point | 447ºC at 760mmHg | |
| Molecular Formula | C13H12O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1ºC | |
| Name | 1-[5-[(5-acetylthiophen-2-yl)methyl]thiophen-2-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 447ºC at 760mmHg |
| Molecular Formula | C13H12O2S2 |
| Molecular Weight | 264.36300 |
| Flash Point | 224.1ºC |
| Exact Mass | 264.02800 |
| PSA | 90.62000 |
| LogP | 3.80560 |
| InChIKey | DFILLCMQRDMPAT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Cc2ccc(C(C)=O)s2)s1 |
| HS Code | 2934999090 |
|---|
|
~%
1-(5-((5-Acetyl... CAS#:34768-06-4 |
| Literature: Cairns et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 1270 |
|
~%
1-(5-((5-Acetyl... CAS#:34768-06-4 |
| Literature: Buu-Hoi et al. Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1955 , vol. 240, p. 442 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| bis-(5-acetyl-[2]thienyl)-methane |
| 1-(5-((5-Acetyl-2-thienyl)methyl)-2-thienyl)ethanone |