N,N-dimethyl-2-(2-nitrophenyl)ethanamine structure
|
Common Name | N,N-dimethyl-2-(2-nitrophenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 3478-91-9 | Molecular Weight | 194.23000 | |
| Density | 1.113g/cm3 | Boiling Point | 279.9ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.1ºC | |
| Name | N,N-dimethyl-2-(2-nitrophenyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 279.9ºC at 760 mmHg |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23000 |
| Flash Point | 123.1ºC |
| Exact Mass | 194.10600 |
| PSA | 49.06000 |
| LogP | 2.22210 |
| Index of Refraction | 1.547 |
| InChIKey | YHUXQYOPOBJOGI-UHFFFAOYSA-N |
| SMILES | CN(C)CCc1ccccc1[N+](=O)[O-] |
|
~%
N,N-dimethyl-2-... CAS#:3478-91-9 |
| Literature: Krapcho; Turk Journal of medicinal chemistry, 1966 , vol. 9, # 6 p. 809 - 812 |
|
~%
N,N-dimethyl-2-... CAS#:3478-91-9 |
| Literature: Goss; Hanhart; Ingold Journal of the Chemical Society, 1927 , p. 260 |
| N,N-dimethyl-2-nitrophenethyl amine |
| 2-Nitro-1-<2-dimethylamino-aethyl>-benzol |