N,N-diethyl-2-(2-nitrophenyl)ethanamine structure
|
Common Name | N,N-diethyl-2-(2-nitrophenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 5339-03-7 | Molecular Weight | 222.28400 | |
| Density | 1.071g/cm3 | Boiling Point | 312.9ºC at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143ºC | |
| Name | diethyl-(2-mesityloxy-ethyl)-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 312.9ºC at 760 mmHg |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.28400 |
| Flash Point | 143ºC |
| Exact Mass | 222.13700 |
| PSA | 49.06000 |
| LogP | 3.00230 |
| Index of Refraction | 1.535 |
| InChIKey | AEJDLJVRULPTBD-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCc1ccccc1[N+](=O)[O-] |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| diethyl-(2-nitro-phenethyl)-amine |
| 2-(Mesityloxy)triethylamine |
| Triethylamine,2-(mesityloxy) |
| Diaethyl-(2-nitro-phenaethyl)-amin |
| Diaethyl-(2-mesityloxy-aethyl)-amin |