Ethyl 2-((2-((tert-butoxycarbonyl)amino)ethyl)amino)acetate hydrochloride structure
|
Common Name | Ethyl 2-((2-((tert-butoxycarbonyl)amino)ethyl)amino)acetate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 347890-34-0 | Molecular Weight | 282.764 | |
| Density | N/A | Boiling Point | 352ºC at 760mmHg | |
| Molecular Formula | C11H23ClN2O4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 166.7ºC | |
Use of Ethyl 2-((2-((tert-butoxycarbonyl)amino)ethyl)amino)acetate hydrochlorideEthyl 2-((2-((tert-butoxycarbonyl)amino)ethyl)amino)acetate hydrochloride is a Glycine (HY-Y0966) derivative[1]. |
| Name | ethyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]acetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Ethyl 2-((2-((tert-butoxycarbonyl)amino)ethyl)amino)acetate hydrochloride is a Glycine (HY-Y0966) derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 352ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H23ClN2O4 |
| Molecular Weight | 282.764 |
| Flash Point | 166.7ºC |
| Exact Mass | 282.134644 |
| PSA | 76.66000 |
| LogP | 2.24760 |
| InChIKey | CZTZMHQGYIOSNM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNCCNC(=O)OC(C)(C)C.Cl |
| Storage condition | ?20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| Ethyl N-[2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)ethyl]glycinate hydrochloride (1:1) |
| Glycine, N-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl]-, ethyl ester, hydrochloride (1:1) |
| N-(Boc-aminoethyl)-Gly-OEt hydrochloride |
| Ethyl [2-(Boc-amino)ethylamino]acetate hydrochloride |
| ethyl n-[(2-boc-amino)ethyl]glycinatehydrochloride |
| Ethyl N-{2-[(tert-butoxycarbonyl)amino]ethyl}glycinate hydrochloride (1:1) |
| Ethyl N-[(2-Boc-amino)ethyl]glycinate HCl |
| N-[2-(Boc-amino)ethyl]glycine ethylester hydrochloride |
| h-(boc-aeg)-oet hcl |
| Ethyl 2-((2-((tert-butoxycarbonyl)amino)ethyl)amino)acetate hydrochloride |