3,4-Di-O-acetyl-L-rhamnal structure
|
Common Name | 3,4-Di-O-acetyl-L-rhamnal | ||
|---|---|---|---|---|
| CAS Number | 34819-86-8 | Molecular Weight | 214.22 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 295.9±0.0 °C at 760 mmHg | |
| Molecular Formula | C10H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.4±27.4 °C | |
Use of 3,4-Di-O-acetyl-L-rhamnal3,4-Di-O-acetyl-L-rhamnal is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 3,4-di-o-acetyl-6-deoxy-l-glucal |
|---|---|
| Synonym | More Synonyms |
| Description | 3,4-Di-O-acetyl-L-rhamnal is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 295.9±0.0 °C at 760 mmHg |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 |
| Flash Point | 116.4±27.4 °C |
| Exact Mass | 214.084122 |
| PSA | 61.83000 |
| LogP | 0.57 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | NDEGMKQAZZBNBB-JUWDTYFHSA-N |
| SMILES | CC(=O)OC1C=COC(C)C1OC(C)=O |
| Storage condition | 2-8°C |
| Safety Phrases | S24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4-Di-O-acetyl-1,5-anhydro-2,6-dideoxy-L-arabino-hex-1-enitol |
| EINECS 252-228-7 |
| L-Rhamnal Diacetate |
| Diacetyl-L-rhamnal |
| 6-Deoxy-L-glucal Diacetate |
| 3,4-di-O-acetyl-1,5-anhydro-2,6-dideoxy-L-arabino-hex-1-enol |
| [(2S,3S,4S)-2-methyl-3,4-dihydro-2H-pyran-3,4-diyl]diacetate |
| L-arabino-Hex-1-enitol, 1,5-anhydro-2,6-dideoxy-, diacetate |
| 3,4-Di-O-acetyl-6-deoxy-L-glucal |
| L-6-deoxy-3,4-diacetylglucal |
| DI-O-ACETYL-L-RHAMNAL |
| 1,5-Dianhydro-2,6-Dideoxy-L-A |
| 3,4-Di-O-acetyl-L-rhamnal |
| MFCD00074970 |