1-Butanone,4,4,4-trifluoro-3-hydroxy-2-methyl-1-phenyl-3-(trifluoromethyl)- structure
|
Common Name | 1-Butanone,4,4,4-trifluoro-3-hydroxy-2-methyl-1-phenyl-3-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 34844-07-0 | Molecular Weight | 300.19700 | |
| Density | 1.378g/cm3 | Boiling Point | 320.1ºC at 760mmHg | |
| Molecular Formula | C12H10F6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.4ºC | |
| Name | 4,4,4-trifluoro-3-hydroxy-2-methyl-1-phenyl-3-(trifluoromethyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 320.1ºC at 760mmHg |
| Molecular Formula | C12H10F6O2 |
| Molecular Weight | 300.19700 |
| Flash Point | 147.4ºC |
| Exact Mass | 300.05800 |
| PSA | 37.30000 |
| LogP | 3.36110 |
| Index of Refraction | 1.438 |
| InChIKey | OJURQAZMBMFRTD-UHFFFAOYSA-N |
| SMILES | CC(C(=O)c1ccccc1)C(O)(C(F)(F)F)C(F)(F)F |
|
~66%
1-Butanone,4,4,... CAS#:34844-07-0 |
| Literature: Ishihara, Takashi; Shinjo, Hiroshi; Inoue, Yoshihisa; Ando, Teiichi Journal of Fluorine Chemistry, 1983 , vol. 22, p. 1 - 20 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Methyl-3-hydroxy-1-phenyl-4,4,4-trifluor-3-trifluormethyl-1-butanon |